C23H15F3N2O3 — CID 86669878
7-(oxiran-2-yl)-3-[5-phenyl-4-(trifluoromethyl)-1,2-oxazol-3-yl]-4,5-dihydrobenzo[g][2,1]benzoxazole (PubChem CID 86669878) has the molecular formula C23H15F3N2O3 and a molecular weight of 424.38 g/mol. Its IUPAC name is 7-(oxiran-2-yl)-3-[5-phenyl-4-(trifluoromethyl)-1,2-oxazol-3-yl]-4,5-dihydrobenzo[g][2,1]benzoxazole.
| Compound Name | 7-(oxiran-2-yl)-3-[5-phenyl-4-(trifluoromethyl)-1,2-oxazol-3-yl]-4,5-dihydrobenzo[g][2,1]benzoxazole |
|---|---|
| PubChem CID | 86669878 |
| Molecular Formula | C23H15F3N2O3 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 7-(oxiran-2-yl)-3-[5-phenyl-4-(trifluoromethyl)-1,2-oxazol-3-yl]-4,5-dihydrobenzo[g][2,1]benzoxazole |
| SMILES | FC(F)(F)c1c(-c2onc3c2CCc2cc(C4CO4)ccc2-3)noc1-c1ccccc1 |
| InChI | InChI=1S/C23H15F3N2O3/c24-23(25,26)18-20(28-30-21(18)12-4-2-1-3-5-12)22-16-9-6-13-10-14(17-11-29-17)7-8-15(13)19(16)27-31-22/h1-5,7-8,10,17H,6,9,11H2 |
| InChIKey | OMQHWXMRSBVFDZ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 64.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|