C19H28N2O4Si — CID 86670157
tert-butyl-dimethyl-[[(3S,4R,8S)-8-methyl-6-(3-nitro-4-pyridinyl)-1-oxaspiro[2.5]oct-5-en-4-yl]oxy]silane (PubChem CID 86670157) has the molecular formula C19H28N2O4Si and a molecular weight of 376.53 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(3S,4R,8S)-8-methyl-6-(3-nitro-4-pyridinyl)-1-oxaspiro[2.5]oct-5-en-4-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(3S,4R,8S)-8-methyl-6-(3-nitro-4-pyridinyl)-1-oxaspiro[2.5]oct-5-en-4-yl]oxy]silane |
|---|---|
| PubChem CID | 86670157 |
| Molecular Formula | C19H28N2O4Si |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | tert-butyl-dimethyl-[[(3S,4R,8S)-8-methyl-6-(3-nitro-4-pyridinyl)-1-oxaspiro[2.5]oct-5-en-4-yl]oxy]silane |
| SMILES | C[C@H]1CC(c2ccncc2[N+](=O)[O-])=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]12CO2 |
| InChI | InChI=1S/C19H28N2O4Si/c1-13-9-14(15-7-8-20-11-16(15)21(22)23)10-17(19(13)12-24-19)25-26(5,6)18(2,3)4/h7-8,10-11,13,17H,9,12H2,1-6H3/t13-,17+,19+/m0/s1 |
| InChIKey | IGJLQKNZBXTNGJ-BOFPYLFWSA-N |
| XLogP | 4.57 |
| TPSA | 77.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|