C23H24F6N6O5S3 — CID 86670409
N-[[(2R)-4-(5-aminothiophen-2-yl)sulfonyl-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-N-phenylmethanesulfonamide (PubChem CID 86670409) has the molecular formula C23H24F6N6O5S3 and a molecular weight of 674.67 g/mol. Its IUPAC name is N-[[(2R)-4-(5-aminothiophen-2-yl)sulfonyl-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-N-phenylmethanesulfonamide.
| Compound Name | N-[[(2R)-4-(5-aminothiophen-2-yl)sulfonyl-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-N-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 86670409 |
| Molecular Formula | C23H24F6N6O5S3 |
| Molecular Weight | 674.67 g/mol |
| Exact Mass | 674.09 |
| IUPAC Name | N-[[(2R)-4-(5-aminothiophen-2-yl)sulfonyl-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-N-phenylmethanesulfonamide |
| SMILES | CS(=O)(=O)N(C[C@H]1CN(S(=O)(=O)c2ccc(N)s2)CCN1c1ncc(C(O)(C(F)(F)F)C(F)(F)F)cn1)c1ccccc1 |
| InChI | InChI=1S/C23H24F6N6O5S3/c1-42(37,38)35(16-5-3-2-4-6-16)14-17-13-33(43(39,40)19-8-7-18(30)41-19)9-10-34(17)20-31-11-15(12-32-20)21(36,22(24,25)26)23(27,28)29/h2-8,11-12,17,36H,9-10,13-14,30H2,1H3/t17-/m1/s1 |
| InChIKey | JWDNUOWJRXVTGM-QGZVFWFLSA-N |
| XLogP | 2.78 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.67 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |