C24H25F6N7O5S2 — CID 86670413
N-[[(2R)-4-[(6-amino-3-pyridinyl)sulfonyl]-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-N-phenylmethanesulfonamide (PubChem CID 86670413) has the molecular formula C24H25F6N7O5S2 and a molecular weight of 669.63 g/mol. Its IUPAC name is N-[[(2R)-4-[(6-amino-3-pyridinyl)sulfonyl]-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-N-phenylmethanesulfonamide.
| Compound Name | N-[[(2R)-4-[(6-amino-3-pyridinyl)sulfonyl]-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-N-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 86670413 |
| Molecular Formula | C24H25F6N7O5S2 |
| Molecular Weight | 669.63 g/mol |
| Exact Mass | 669.13 |
| IUPAC Name | N-[[(2R)-4-[(6-amino-3-pyridinyl)sulfonyl]-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-N-phenylmethanesulfonamide |
| SMILES | CS(=O)(=O)N(C[C@H]1CN(S(=O)(=O)c2ccc(N)nc2)CCN1c1ncc(C(O)(C(F)(F)F)C(F)(F)F)cn1)c1ccccc1 |
| InChI | InChI=1S/C24H25F6N7O5S2/c1-43(39,40)37(17-5-3-2-4-6-17)15-18-14-35(44(41,42)19-7-8-20(31)32-13-19)9-10-36(18)21-33-11-16(12-34-21)22(38,23(25,26)27)24(28,29)30/h2-8,11-13,18,38H,9-10,14-15H2,1H3,(H2,31,32)/t18-/m1/s1 |
| InChIKey | NYNCVJPXEMGPHM-GOSISDBHSA-N |
| XLogP | 2.11 |
| TPSA | 162.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.63 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |