C17H18F3N3O5S — CID 86670578
methyl 3-(2-methylpiperidin-1-yl)-2-(trifluoromethylsulfonyloxy)quinoxaline-6-carboxylate (PubChem CID 86670578) has the molecular formula C17H18F3N3O5S and a molecular weight of 433.41 g/mol. Its IUPAC name is methyl 3-(2-methylpiperidin-1-yl)-2-(trifluoromethylsulfonyloxy)quinoxaline-6-carboxylate.
| Compound Name | methyl 3-(2-methylpiperidin-1-yl)-2-(trifluoromethylsulfonyloxy)quinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 86670578 |
| Molecular Formula | C17H18F3N3O5S |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | methyl 3-(2-methylpiperidin-1-yl)-2-(trifluoromethylsulfonyloxy)quinoxaline-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(OS(=O)(=O)C(F)(F)F)c(N3CCCCC3C)nc2c1 |
| InChI | InChI=1S/C17H18F3N3O5S/c1-10-5-3-4-8-23(10)14-15(28-29(25,26)17(18,19)20)22-12-7-6-11(16(24)27-2)9-13(12)21-14/h6-7,9-10H,3-5,8H2,1-2H3 |
| InChIKey | LSOMBEQQIOGHEN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|