About 3-[3-[[3,5-bis(trifluoromethyl)benzoyl]-methylamino]-4-pyridinyl]-4-methylbenzoic acid
3-[3-[[3,5-bis(trifluoromethyl)benzoyl]-methylamino]-4-pyridinyl]-4-methylbenzoic acid (PubChem CID 86670720) has the molecular formula C23H16F6N2O3
and a molecular weight of 482.38 g/mol. Its IUPAC name is 3-[3-[[3,5-bis(trifluoromethyl)benzoyl]-methylamino]-4-pyridinyl]-4-methylbenzoic acid.
Molecular Properties
| Compound Name | 3-[3-[[3,5-bis(trifluoromethyl)benzoyl]-methylamino]-4-pyridinyl]-4-methylbenzoic acid |
| PubChem CID | 86670720 |
| Molecular Formula | C23H16F6N2O3 |
| Molecular Weight | 482.38 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 3-[3-[[3,5-bis(trifluoromethyl)benzoyl]-methylamino]-4-pyridinyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1-c1ccncc1N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H16F6N2O3/c1-12-3-4-13(21(33)34)9-18(12)17-5-6-30-11-19(17)31(2)20(32)14-7-15(22(24,25)26)10-16(8-14)23(27,28)29/h3-11H,1-2H3,(H,33,34) |
| InChIKey | LIGAVRYZGQXTDR-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.38 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-[[3,5-bis(trifluoromethyl)benzoyl]-methylamino]-4-pyridinyl]-4-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[[3,5-bis(trifluoromethyl)benzoyl]-methylamino]-4-pyridinyl]-4-methylbenzoic acid?
The IUPAC name of 3-[3-[[3,5-bis(trifluoromethyl)benzoyl]-methylamino]-4-pyridinyl]-4-methylbenzoic acid (CID 86670720) is 3-[3-[[3,5-bis(trifluoromethyl)benzoyl]-methylamino]-4-pyridinyl]-4-methylbenzoic acid.
What is the SMILES notation for 3-[3-[[3,5-bis(trifluoromethyl)benzoyl]-methylamino]-4-pyridinyl]-4-methylbenzoic acid?
The canonical SMILES for 3-[3-[[3,5-bis(trifluoromethyl)benzoyl]-methylamino]-4-pyridinyl]-4-methylbenzoic acid is Cc1ccc(C(=O)O)cc1-c1ccncc1N(C)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 3-[3-[[3,5-bis(trifluoromethyl)benzoyl]-methylamino]-4-pyridinyl]-4-methylbenzoic acid?
The InChIKey is LIGAVRYZGQXTDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16F6N2O3/c1-12-3-4-13(21(33)34)9-18(12)17-5-6-30-11-19(17)31(2)20(32)14-7-15(22(24,25)26)10-16(8-14)23(27,28)29/h3-11H,1-2H3,(H,33,34).
What are the key properties of 3-[3-[[3,5-bis(trifluoromethyl)benzoyl]-methylamino]-4-pyridinyl]-4-methylbenzoic acid?
3-[3-[[3,5-bis(trifluoromethyl)benzoyl]-methylamino]-4-pyridinyl]-4-methylbenzoic acid has a molecular weight of 482.38 g/mol, XLogP of 6.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[[3,5-bis(trifluoromethyl)benzoyl]-methylamino]-4-pyridinyl]-4-methylbenzoic acid is sourced from PubChem (CID 86670720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).