C23H23F6N3O — CID 86671004
2-[4-[[4-(5-aminoindol-1-yl)piperidin-1-yl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 86671004) has the molecular formula C23H23F6N3O and a molecular weight of 471.45 g/mol. Its IUPAC name is 2-[4-[[4-(5-aminoindol-1-yl)piperidin-1-yl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[[4-(5-aminoindol-1-yl)piperidin-1-yl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 86671004 |
| Molecular Formula | C23H23F6N3O |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2-[4-[[4-(5-aminoindol-1-yl)piperidin-1-yl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1ccc2c(ccn2C2CCN(Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C23H23F6N3O/c24-22(25,26)21(33,23(27,28)29)17-3-1-15(2-4-17)14-31-10-8-19(9-11-31)32-12-7-16-13-18(30)5-6-20(16)32/h1-7,12-13,19,33H,8-11,14,30H2 |
| InChIKey | UUGZTDBGEYAWDE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 54.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|