C24H28N2O3 — CID 86671213
(7aS,9R,11aR)-11a-ethyl-N-(2-methyl-3-pyridinyl)spiro[6,7,7a,8,10,11-hexahydrobenzo[d][1]benzoxepine-9,2'-oxirane]-3-carboxamide (PubChem CID 86671213) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is (7aS,9R,11aR)-11a-ethyl-N-(2-methyl-3-pyridinyl)spiro[6,7,7a,8,10,11-hexahydrobenzo[d][1]benzoxepine-9,2'-oxirane]-3-carboxamide.
| Compound Name | (7aS,9R,11aR)-11a-ethyl-N-(2-methyl-3-pyridinyl)spiro[6,7,7a,8,10,11-hexahydrobenzo[d][1]benzoxepine-9,2'-oxirane]-3-carboxamide |
|---|---|
| PubChem CID | 86671213 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (7aS,9R,11aR)-11a-ethyl-N-(2-methyl-3-pyridinyl)spiro[6,7,7a,8,10,11-hexahydrobenzo[d][1]benzoxepine-9,2'-oxirane]-3-carboxamide |
| SMILES | CC[C@@]12CC[C@]3(CO3)C[C@@H]1CCOc1cc(C(=O)Nc3cccnc3C)ccc12 |
| InChI | InChI=1S/C24H28N2O3/c1-3-24-10-9-23(15-29-23)14-18(24)8-12-28-21-13-17(6-7-19(21)24)22(27)26-20-5-4-11-25-16(20)2/h4-7,11,13,18H,3,8-10,12,14-15H2,1-2H3,(H,26,27)/t18-,23+,24+/m0/s1 |
| InChIKey | FKZQKKYWRDOOCR-NTUVXCKYSA-N |
| XLogP | 4.64 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|