C11H17F3N2O6 — CID 86671357
methyl 2-[[(2S)-2-amino-3-prop-2-enoxypropanoyl]amino]acetate;2,2,2-trifluoroacetic acid (PubChem CID 86671357) has the molecular formula C11H17F3N2O6 and a molecular weight of 330.26 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-amino-3-prop-2-enoxypropanoyl]amino]acetate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 2-[[(2S)-2-amino-3-prop-2-enoxypropanoyl]amino]acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86671357 |
| Molecular Formula | C11H17F3N2O6 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | methyl 2-[[(2S)-2-amino-3-prop-2-enoxypropanoyl]amino]acetate;2,2,2-trifluoroacetic acid |
| SMILES | C=CCOC[C@H](N)C(=O)NCC(=O)OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H16N2O4.C2HF3O2/c1-3-4-15-6-7(10)9(13)11-5-8(12)14-2;3-2(4,5)1(6)7/h3,7H,1,4-6,10H2,2H3,(H,11,13);(H,6,7)/t7-;/m0./s1 |
| InChIKey | SQKDGJMYHZYCLF-FJXQXJEOSA-N |
| XLogP | -0.56 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|