C7H6N6 — CID 86671437
7-(azidomethyl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 86671437) has the molecular formula C7H6N6 and a molecular weight of 174.17 g/mol. Its IUPAC name is 7-(azidomethyl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 7-(azidomethyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 86671437 |
| Molecular Formula | C7H6N6 |
| Molecular Weight | 174.17 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 7-(azidomethyl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | [N-]=[N+]=NCc1ccn2ncnc2c1 |
| InChI | InChI=1S/C7H6N6/c8-12-10-4-6-1-2-13-7(3-6)9-5-11-13/h1-3,5H,4H2 |
| InChIKey | TWXYYBJNHBGRBB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 78.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.17 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|