C31H38F3N3O4 — CID 86671678
N-[[4-butoxy-3-[1-[1-(2-methoxyethyl)-7-methylindole-3-carbonyl]piperidin-4-yl]phenyl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 86671678) has the molecular formula C31H38F3N3O4 and a molecular weight of 573.66 g/mol. Its IUPAC name is N-[[4-butoxy-3-[1-[1-(2-methoxyethyl)-7-methylindole-3-carbonyl]piperidin-4-yl]phenyl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[4-butoxy-3-[1-[1-(2-methoxyethyl)-7-methylindole-3-carbonyl]piperidin-4-yl]phenyl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 86671678 |
| Molecular Formula | C31H38F3N3O4 |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | N-[[4-butoxy-3-[1-[1-(2-methoxyethyl)-7-methylindole-3-carbonyl]piperidin-4-yl]phenyl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | CCCCOc1ccc(CNC(=O)C(F)(F)F)cc1C1CCN(C(=O)c2cn(CCOC)c3c(C)cccc23)CC1 |
| InChI | InChI=1S/C31H38F3N3O4/c1-4-5-16-41-27-10-9-22(19-35-30(39)31(32,33)34)18-25(27)23-11-13-36(14-12-23)29(38)26-20-37(15-17-40-3)28-21(2)7-6-8-24(26)28/h6-10,18,20,23H,4-5,11-17,19H2,1-3H3,(H,35,39) |
| InChIKey | ZQIRRWJKZWXWRV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|