C11H12F3N3O — CID 86672009
(4S,5S)-4-(5-amino-2-fluorophenyl)-5-fluoro-4-(fluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine (PubChem CID 86672009) has the molecular formula C11H12F3N3O and a molecular weight of 259.23 g/mol. Its IUPAC name is (4S,5S)-4-(5-amino-2-fluorophenyl)-5-fluoro-4-(fluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine.
| Compound Name | (4S,5S)-4-(5-amino-2-fluorophenyl)-5-fluoro-4-(fluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 86672009 |
| Molecular Formula | C11H12F3N3O |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | (4S,5S)-4-(5-amino-2-fluorophenyl)-5-fluoro-4-(fluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine |
| SMILES | NC1=N[C@](CF)(c2cc(N)ccc2F)[C@H](F)CO1 |
| InChI | InChI=1S/C11H12F3N3O/c12-5-11(9(14)4-18-10(16)17-11)7-3-6(15)1-2-8(7)13/h1-3,9H,4-5,15H2,(H2,16,17)/t9-,11-/m1/s1 |
| InChIKey | QXLLGBZZZGTOKI-MWLCHTKSSA-N |
| XLogP | 1.26 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|