About SCHEMBL13275758
SCHEMBL13275758 (PubChem CID 86672586) has the molecular formula C38H36Cl2FN3O4
and a molecular weight of 688.63 g/mol.
Molecular Properties
| Compound Name | SCHEMBL13275758 |
| PubChem CID | 86672586 |
| Molecular Formula | C38H36Cl2FN3O4 |
| Molecular Weight | 688.63 g/mol |
| Exact Mass | 687.21 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC2(CC1)N([C@H](c1ccccc1)[C@@H](O)c1ccccc1)[C@@H](C(=O)O)[C@H](c1ccnc(Cl)c1F)C21C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C38H36Cl2FN3O4/c1-36(2)16-18-37(19-17-36)38(26-14-13-24(39)21-27(26)43-35(38)48)28(25-15-20-42-33(40)29(25)41)31(34(46)47)44(37)30(22-9-5-3-6-10-22)32(45)23-11-7-4-8-12-23/h3-15,20-21,28,30-32,45H,16-19H2,1-2H3,(H,43,48)(H,46,47)/t28-,30+,31+,32-,38?/m0/s1 |
| InChIKey | QRWOREMFCCXREQ-DOEDXNARSA-N |
| XLogP | 8.08 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 688.63 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze SCHEMBL13275758 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of SCHEMBL13275758?
The IUPAC name of SCHEMBL13275758 (CID 86672586) is not available.
What is the SMILES notation for SCHEMBL13275758?
The canonical SMILES for SCHEMBL13275758 is CC1(C)CCC2(CC1)N([C@H](c1ccccc1)[C@@H](O)c1ccccc1)[C@@H](C(=O)O)[C@H](c1ccnc(Cl)c1F)C21C(=O)Nc2cc(Cl)ccc21.
What is the InChIKey of SCHEMBL13275758?
The InChIKey is QRWOREMFCCXREQ-DOEDXNARSA-N. The full InChI is InChI=1S/C38H36Cl2FN3O4/c1-36(2)16-18-37(19-17-36)38(26-14-13-24(39)21-27(26)43-35(38)48)28(25-15-20-42-33(40)29(25)41)31(34(46)47)44(37)30(22-9-5-3-6-10-22)32(45)23-11-7-4-8-12-23/h3-15,20-21,28,30-32,45H,16-19H2,1-2H3,(H,43,48)(H,46,47)/t28-,30+,31+,32-,38?/m0/s1.
What are the key properties of SCHEMBL13275758?
SCHEMBL13275758 has a molecular weight of 688.63 g/mol, XLogP of 8.08, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for SCHEMBL13275758 is sourced from PubChem (CID 86672586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).