C31H35Cl2FN4O5 — CID 86672596
SCHEMBL13469071 (PubChem CID 86672596) has the molecular formula C31H35Cl2FN4O5 and a molecular weight of 633.55 g/mol.
| Compound Name | SCHEMBL13469071 |
|---|---|
| PubChem CID | 86672596 |
| Molecular Formula | C31H35Cl2FN4O5 |
| Molecular Weight | 633.55 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@@H]1CC[C@@H](NC(=O)[C@@H]2NC3(CCC(C)(C)CC3)[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2ccnc(Cl)c2F)CO1 |
| InChI | InChI=1S/C31H35Cl2FN4O5/c1-29(2)9-11-30(12-10-29)31(19-6-4-16(32)14-20(19)37-28(31)41)22(18-8-13-35-25(33)23(18)34)24(38-30)26(39)36-17-5-7-21(43-15-17)27(40)42-3/h4,6,8,13-14,17,21-22,24,38H,5,7,9-12,15H2,1-3H3,(H,36,39)(H,37,41)/t17-,21+,22+,24-,31-/m1/s1 |
| InChIKey | JATHXOTWIMCLRW-DYWXSRFWSA-N |
| XLogP | 4.65 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|