About SCHEMBL13275959
SCHEMBL13275959 (PubChem CID 86672598) has the molecular formula C38H34Cl2FN3O3
and a molecular weight of 670.61 g/mol.
Molecular Properties
| Compound Name | SCHEMBL13275959 |
| PubChem CID | 86672598 |
| Molecular Formula | C38H34Cl2FN3O3 |
| Molecular Weight | 670.61 g/mol |
| Exact Mass | 669.20 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC2(CC1)N1[C@H](c3ccccc3)[C@H](c3ccccc3)OC(=O)[C@H]1[C@H](c1cccc(Cl)c1F)[C@@]21C(=O)Nc2cc(Cl)ncc21 |
| InChI | InChI=1S/C38H34Cl2FN3O3/c1-36(2)16-18-37(19-17-36)38(25-21-42-28(40)20-27(25)43-35(38)46)29(24-14-9-15-26(39)30(24)41)32-34(45)47-33(23-12-7-4-8-13-23)31(44(32)37)22-10-5-3-6-11-22/h3-15,20-21,29,31-33H,16-19H2,1-2H3,(H,43,46)/t29-,31+,32+,33-,38-/m0/s1 |
| InChIKey | CTHJIKWVFVUGPK-CHIGUGJNSA-N |
| XLogP | 8.56 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 670.61 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze SCHEMBL13275959 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of SCHEMBL13275959?
The IUPAC name of SCHEMBL13275959 (CID 86672598) is not available.
What is the SMILES notation for SCHEMBL13275959?
The canonical SMILES for SCHEMBL13275959 is CC1(C)CCC2(CC1)N1[C@H](c3ccccc3)[C@H](c3ccccc3)OC(=O)[C@H]1[C@H](c1cccc(Cl)c1F)[C@@]21C(=O)Nc2cc(Cl)ncc21.
What is the InChIKey of SCHEMBL13275959?
The InChIKey is CTHJIKWVFVUGPK-CHIGUGJNSA-N. The full InChI is InChI=1S/C38H34Cl2FN3O3/c1-36(2)16-18-37(19-17-36)38(25-21-42-28(40)20-27(25)43-35(38)46)29(24-14-9-15-26(39)30(24)41)32-34(45)47-33(23-12-7-4-8-13-23)31(44(32)37)22-10-5-3-6-11-22/h3-15,20-21,29,31-33H,16-19H2,1-2H3,(H,43,46)/t29-,31+,32+,33-,38-/m0/s1.
What are the key properties of SCHEMBL13275959?
SCHEMBL13275959 has a molecular weight of 670.61 g/mol, XLogP of 8.56, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for SCHEMBL13275959 is sourced from PubChem (CID 86672598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).