C26H32F3N4O3S2+ — CID 86672735
N-[1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-yl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 86672735) has the molecular formula C26H32F3N4O3S2+ and a molecular weight of 569.70 g/mol. Its IUPAC name is N-[1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-yl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-yl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 86672735 |
| Molecular Formula | C26H32F3N4O3S2+ |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | N-[1-(1,9-diethyl-7-morpholin-4-ylphenothiazin-3-ylidene)piperidin-1-ium-4-yl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCc1cc(=[N+]2CCC(NS(=O)(=O)C(F)(F)F)CC2)cc2sc3cc(N4CCOCC4)cc(CC)c3nc1-2 |
| InChI | InChI=1S/C26H32F3N4O3S2/c1-3-17-13-20(32-7-5-19(6-8-32)31-38(34,35)26(27,28)29)15-22-24(17)30-25-18(4-2)14-21(16-23(25)37-22)33-9-11-36-12-10-33/h13-16,19,31H,3-12H2,1-2H3/q+1 |
| InChIKey | AUBJBDOTAQRBBT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|