About 4-[7-(1,4-diazepan-1-yl)-9-fluorophenothiazin-3-ylidene]morpholin-4-ium chloride
4-[7-(1,4-diazepan-1-yl)-9-fluorophenothiazin-3-ylidene]morpholin-4-ium chloride (PubChem CID 86672748) has the molecular formula C21H24ClFN4OS
and a molecular weight of 434.97 g/mol. Its IUPAC name is 4-[7-(1,4-diazepan-1-yl)-9-fluorophenothiazin-3-ylidene]morpholin-4-ium chloride.
Molecular Properties
| Compound Name | 4-[7-(1,4-diazepan-1-yl)-9-fluorophenothiazin-3-ylidene]morpholin-4-ium chloride |
| PubChem CID | 86672748 |
| Molecular Formula | C21H24ClFN4OS |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 4-[7-(1,4-diazepan-1-yl)-9-fluorophenothiazin-3-ylidene]morpholin-4-ium chloride |
| SMILES | Fc1cc(N2CCCNCC2)cc2sc3cc(=[N+]4CCOCC4)ccc-3nc12.[Cl-] |
| InChI | InChI=1S/C21H24FN4OS.ClH/c22-17-12-16(25-6-1-4-23-5-7-25)14-20-21(17)24-18-3-2-15(13-19(18)28-20)26-8-10-27-11-9-26;/h2-3,12-14,23H,1,4-11H2;1H/q+1;/p-1 |
| InChIKey | OPBLVJHYVZBSRH-UHFFFAOYSA-M |
| XLogP | -0.85 |
| TPSA | 40.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[7-(1,4-diazepan-1-yl)-9-fluorophenothiazin-3-ylidene]morpholin-4-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[7-(1,4-diazepan-1-yl)-9-fluorophenothiazin-3-ylidene]morpholin-4-ium chloride?
The IUPAC name of 4-[7-(1,4-diazepan-1-yl)-9-fluorophenothiazin-3-ylidene]morpholin-4-ium chloride (CID 86672748) is 4-[7-(1,4-diazepan-1-yl)-9-fluorophenothiazin-3-ylidene]morpholin-4-ium chloride.
What is the SMILES notation for 4-[7-(1,4-diazepan-1-yl)-9-fluorophenothiazin-3-ylidene]morpholin-4-ium chloride?
The canonical SMILES for 4-[7-(1,4-diazepan-1-yl)-9-fluorophenothiazin-3-ylidene]morpholin-4-ium chloride is Fc1cc(N2CCCNCC2)cc2sc3cc(=[N+]4CCOCC4)ccc-3nc12.[Cl-].
What is the InChIKey of 4-[7-(1,4-diazepan-1-yl)-9-fluorophenothiazin-3-ylidene]morpholin-4-ium chloride?
The InChIKey is OPBLVJHYVZBSRH-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H24FN4OS.ClH/c22-17-12-16(25-6-1-4-23-5-7-25)14-20-21(17)24-18-3-2-15(13-19(18)28-20)26-8-10-27-11-9-26;/h2-3,12-14,23H,1,4-11H2;1H/q+1;/p-1.
What are the key properties of 4-[7-(1,4-diazepan-1-yl)-9-fluorophenothiazin-3-ylidene]morpholin-4-ium chloride?
4-[7-(1,4-diazepan-1-yl)-9-fluorophenothiazin-3-ylidene]morpholin-4-ium chloride has a molecular weight of 434.97 g/mol, XLogP of -0.85, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[7-(1,4-diazepan-1-yl)-9-fluorophenothiazin-3-ylidene]morpholin-4-ium chloride is sourced from PubChem (CID 86672748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).