About 2-bromo-5-isocyanato-1,3-dimethylbenzene
2-bromo-5-isocyanato-1,3-dimethylbenzene (PubChem CID 86672765) has the molecular formula C9H8BrNO
and a molecular weight of 226.07 g/mol. Its IUPAC name is 2-bromo-5-isocyanato-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | 2-bromo-5-isocyanato-1,3-dimethylbenzene |
| PubChem CID | 86672765 |
| Molecular Formula | C9H8BrNO |
| Molecular Weight | 226.07 g/mol |
| Exact Mass | 224.98 |
| IUPAC Name | 2-bromo-5-isocyanato-1,3-dimethylbenzene |
| SMILES | Cc1cc(N=C=O)cc(C)c1Br |
| InChI | InChI=1S/C9H8BrNO/c1-6-3-8(11-5-12)4-7(2)9(6)10/h3-4H,1-2H3 |
| InChIKey | AJVVGMPXTVEDHV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.07 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-isocyanato-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-isocyanato-1,3-dimethylbenzene?
The IUPAC name of 2-bromo-5-isocyanato-1,3-dimethylbenzene (CID 86672765) is 2-bromo-5-isocyanato-1,3-dimethylbenzene.
What is the SMILES notation for 2-bromo-5-isocyanato-1,3-dimethylbenzene?
The canonical SMILES for 2-bromo-5-isocyanato-1,3-dimethylbenzene is Cc1cc(N=C=O)cc(C)c1Br.
What is the InChIKey of 2-bromo-5-isocyanato-1,3-dimethylbenzene?
The InChIKey is AJVVGMPXTVEDHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO/c1-6-3-8(11-5-12)4-7(2)9(6)10/h3-4H,1-2H3.
What are the key properties of 2-bromo-5-isocyanato-1,3-dimethylbenzene?
2-bromo-5-isocyanato-1,3-dimethylbenzene has a molecular weight of 226.07 g/mol, XLogP of 3.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-isocyanato-1,3-dimethylbenzene is sourced from PubChem (CID 86672765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).