About N-(4-bromo-3,5-dimethylphenyl)-N-[2-(2-fluoroethoxy)ethyl]acetamide
N-(4-bromo-3,5-dimethylphenyl)-N-[2-(2-fluoroethoxy)ethyl]acetamide (PubChem CID 86672768) has the molecular formula C14H19BrFNO2
and a molecular weight of 332.21 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-N-[2-(2-fluoroethoxy)ethyl]acetamide.
Molecular Properties
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-N-[2-(2-fluoroethoxy)ethyl]acetamide |
| PubChem CID | 86672768 |
| Molecular Formula | C14H19BrFNO2 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-N-[2-(2-fluoroethoxy)ethyl]acetamide |
| SMILES | CC(=O)N(CCOCCF)c1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C14H19BrFNO2/c1-10-8-13(9-11(2)14(10)15)17(12(3)18)5-7-19-6-4-16/h8-9H,4-7H2,1-3H3 |
| InChIKey | AYXQVWBNILFUJQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromo-3,5-dimethylphenyl)-N-[2-(2-fluoroethoxy)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-3,5-dimethylphenyl)-N-[2-(2-fluoroethoxy)ethyl]acetamide?
The IUPAC name of N-(4-bromo-3,5-dimethylphenyl)-N-[2-(2-fluoroethoxy)ethyl]acetamide (CID 86672768) is N-(4-bromo-3,5-dimethylphenyl)-N-[2-(2-fluoroethoxy)ethyl]acetamide.
What is the SMILES notation for N-(4-bromo-3,5-dimethylphenyl)-N-[2-(2-fluoroethoxy)ethyl]acetamide?
The canonical SMILES for N-(4-bromo-3,5-dimethylphenyl)-N-[2-(2-fluoroethoxy)ethyl]acetamide is CC(=O)N(CCOCCF)c1cc(C)c(Br)c(C)c1.
What is the InChIKey of N-(4-bromo-3,5-dimethylphenyl)-N-[2-(2-fluoroethoxy)ethyl]acetamide?
The InChIKey is AYXQVWBNILFUJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrFNO2/c1-10-8-13(9-11(2)14(10)15)17(12(3)18)5-7-19-6-4-16/h8-9H,4-7H2,1-3H3.
What are the key properties of N-(4-bromo-3,5-dimethylphenyl)-N-[2-(2-fluoroethoxy)ethyl]acetamide?
N-(4-bromo-3,5-dimethylphenyl)-N-[2-(2-fluoroethoxy)ethyl]acetamide has a molecular weight of 332.21 g/mol, XLogP of 3.40, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-3,5-dimethylphenyl)-N-[2-(2-fluoroethoxy)ethyl]acetamide is sourced from PubChem (CID 86672768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).