About 4-bromo-N-(2-fluoroethyl)-3,5-dimethylaniline
4-bromo-N-(2-fluoroethyl)-3,5-dimethylaniline (PubChem CID 86672778) has the molecular formula C10H13BrFN
and a molecular weight of 246.12 g/mol. Its IUPAC name is 4-bromo-N-(2-fluoroethyl)-3,5-dimethylaniline.
Molecular Properties
| Compound Name | 4-bromo-N-(2-fluoroethyl)-3,5-dimethylaniline |
| PubChem CID | 86672778 |
| Molecular Formula | C10H13BrFN |
| Molecular Weight | 246.12 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 4-bromo-N-(2-fluoroethyl)-3,5-dimethylaniline |
| SMILES | Cc1cc(NCCF)cc(C)c1Br |
| InChI | InChI=1S/C10H13BrFN/c1-7-5-9(13-4-3-12)6-8(2)10(7)11/h5-6,13H,3-4H2,1-2H3 |
| InChIKey | JLPLFBINVTWEML-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.12 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-N-(2-fluoroethyl)-3,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(2-fluoroethyl)-3,5-dimethylaniline?
The IUPAC name of 4-bromo-N-(2-fluoroethyl)-3,5-dimethylaniline (CID 86672778) is 4-bromo-N-(2-fluoroethyl)-3,5-dimethylaniline.
What is the SMILES notation for 4-bromo-N-(2-fluoroethyl)-3,5-dimethylaniline?
The canonical SMILES for 4-bromo-N-(2-fluoroethyl)-3,5-dimethylaniline is Cc1cc(NCCF)cc(C)c1Br.
What is the InChIKey of 4-bromo-N-(2-fluoroethyl)-3,5-dimethylaniline?
The InChIKey is JLPLFBINVTWEML-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrFN/c1-7-5-9(13-4-3-12)6-8(2)10(7)11/h5-6,13H,3-4H2,1-2H3.
What are the key properties of 4-bromo-N-(2-fluoroethyl)-3,5-dimethylaniline?
4-bromo-N-(2-fluoroethyl)-3,5-dimethylaniline has a molecular weight of 246.12 g/mol, XLogP of 3.45, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(2-fluoroethyl)-3,5-dimethylaniline is sourced from PubChem (CID 86672778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).