C17H19F5O2 — CID 86672783
benzyl 4-(2,2,3,3,3-pentafluoropropyl)cyclohexane-1-carboxylate (PubChem CID 86672783) has the molecular formula C17H19F5O2 and a molecular weight of 350.33 g/mol. Its IUPAC name is benzyl 4-(2,2,3,3,3-pentafluoropropyl)cyclohexane-1-carboxylate.
| Compound Name | benzyl 4-(2,2,3,3,3-pentafluoropropyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 86672783 |
| Molecular Formula | C17H19F5O2 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | benzyl 4-(2,2,3,3,3-pentafluoropropyl)cyclohexane-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1CCC(CC(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H19F5O2/c18-16(19,17(20,21)22)10-12-6-8-14(9-7-12)15(23)24-11-13-4-2-1-3-5-13/h1-5,12,14H,6-11H2 |
| InChIKey | MXSVJJQPROMSFC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|