C25H33F3O6SSi — CID 86672800
[(4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl trifluoromethanesulfonate (PubChem CID 86672800) has the molecular formula C25H33F3O6SSi and a molecular weight of 546.68 g/mol. Its IUPAC name is [(4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86672800 |
| Molecular Formula | C25H33F3O6SSi |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | [(4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl trifluoromethanesulfonate |
| SMILES | CC1(C)O[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](COS(=O)(=O)C(F)(F)F)O1 |
| InChI | InChI=1S/C25H33F3O6SSi/c1-23(2,3)36(19-12-8-6-9-13-19,20-14-10-7-11-15-20)32-17-16-21-22(34-24(4,5)33-21)18-31-35(29,30)25(26,27)28/h6-15,21-22H,16-18H2,1-5H3/t21-,22+/m0/s1 |
| InChIKey | MOPIFDABXVVIAS-FCHUYYIVSA-N |
| XLogP | 4.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|