C27H43N3O2 — CID 86673201
(4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[[2-(methylamino)acetyl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 86673201) has the molecular formula C27H43N3O2 and a molecular weight of 441.66 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[[2-(methylamino)acetyl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[[2-(methylamino)acetyl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 86673201 |
| Molecular Formula | C27H43N3O2 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.34 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[[2-(methylamino)acetyl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCNC(=O)CNC |
| InChI | InChI=1S/C27H43N3O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-26(31)29-23-24-30-27(32)25-28-2/h4-5,7-8,10-11,13-14,16-17,19-20,28H,3,6,9,12,15,18,21-25H2,1-2H3,(H,29,31)(H,30,32)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | WDSIXTQSUGLPGU-JDPCYWKWSA-N |
| XLogP | 4.92 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|