C15H25F8NO5 — CID 86673244
2,2,3,3,4,4,5,5-octafluoro-6-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]hexan-1-amine (PubChem CID 86673244) has the molecular formula C15H25F8NO5 and a molecular weight of 451.35 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-6-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]hexan-1-amine.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-6-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]hexan-1-amine |
|---|---|
| PubChem CID | 86673244 |
| Molecular Formula | C15H25F8NO5 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-6-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]hexan-1-amine |
| SMILES | COCCOCCOCCOCCOCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CN |
| InChI | InChI=1S/C15H25F8NO5/c1-25-2-3-26-4-5-27-6-7-28-8-9-29-11-13(18,19)15(22,23)14(20,21)12(16,17)10-24/h2-11,24H2,1H3 |
| InChIKey | VKYYQPCDMCTBGV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|