C11H14F8O4S2 — CID 86673269
ethyl 2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanoate (PubChem CID 86673269) has the molecular formula C11H14F8O4S2 and a molecular weight of 426.35 g/mol. Its IUPAC name is ethyl 2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanoate.
| Compound Name | ethyl 2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanoate |
|---|---|
| PubChem CID | 86673269 |
| Molecular Formula | C11H14F8O4S2 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | ethyl 2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanoate |
| SMILES | CCOC(=O)C(CCSC(F)(F)F)S(=O)(=O)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H14F8O4S2/c1-2-23-8(20)7(3-5-24-11(17,18)19)25(21,22)6-4-9(12,13)10(14,15)16/h7H,2-6H2,1H3 |
| InChIKey | NZEYUNDOFSLELY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|