C24H29F6N3O3 — CID 86673299
(2S)-5-cyclopropyl-N-[(3S)-1-(cyclopropylamino)-1,2-dioxopentan-3-yl]-4,4-difluoro-2-[[(1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]pentanamide (PubChem CID 86673299) has the molecular formula C24H29F6N3O3 and a molecular weight of 521.50 g/mol. Its IUPAC name is (2S)-5-cyclopropyl-N-[(3S)-1-(cyclopropylamino)-1,2-dioxopentan-3-yl]-4,4-difluoro-2-[[(1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]pentanamide.
| Compound Name | (2S)-5-cyclopropyl-N-[(3S)-1-(cyclopropylamino)-1,2-dioxopentan-3-yl]-4,4-difluoro-2-[[(1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]pentanamide |
|---|---|
| PubChem CID | 86673299 |
| Molecular Formula | C24H29F6N3O3 |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | (2S)-5-cyclopropyl-N-[(3S)-1-(cyclopropylamino)-1,2-dioxopentan-3-yl]-4,4-difluoro-2-[[(1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]pentanamide |
| SMILES | CC[C@H](NC(=O)[C@H](CC(F)(F)CC1CC1)N[C@@H](c1ccc(F)cc1)C(F)(F)F)C(=O)C(=O)NC1CC1 |
| InChI | InChI=1S/C24H29F6N3O3/c1-2-17(19(34)22(36)31-16-9-10-16)33-21(35)18(12-23(26,27)11-13-3-4-13)32-20(24(28,29)30)14-5-7-15(25)8-6-14/h5-8,13,16-18,20,32H,2-4,9-12H2,1H3,(H,31,36)(H,33,35)/t17-,18-,20-/m0/s1 |
| InChIKey | YPSJYZZQTARWNO-BJLQDIEVSA-N |
| XLogP | 3.96 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|