C13H12BrF3N2O2 — CID 86673574
(6S,7aS)-6-bromo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-3-one (PubChem CID 86673574) has the molecular formula C13H12BrF3N2O2 and a molecular weight of 365.15 g/mol. Its IUPAC name is (6S,7aS)-6-bromo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-3-one.
| Compound Name | (6S,7aS)-6-bromo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-3-one |
|---|---|
| PubChem CID | 86673574 |
| Molecular Formula | C13H12BrF3N2O2 |
| Molecular Weight | 365.15 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | (6S,7aS)-6-bromo-2-[4-(trifluoromethoxy)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-3-one |
| SMILES | O=C1N(c2ccc(OC(F)(F)F)cc2)C[C@@H]2C[C@H](Br)CN12 |
| InChI | InChI=1S/C13H12BrF3N2O2/c14-8-5-10-7-19(12(20)18(10)6-8)9-1-3-11(4-2-9)21-13(15,16)17/h1-4,8,10H,5-7H2/t8-,10-/m0/s1 |
| InChIKey | QZRUHAJGLDGCOV-WPRPVWTQSA-N |
| XLogP | 3.36 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.15 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|