C22H21F3O4S2 — CID 86673630
1,1,2-trifluoro-4-hydroxybutane-1-sulfonate;triphenylsulfanium (PubChem CID 86673630) has the molecular formula C22H21F3O4S2 and a molecular weight of 470.53 g/mol. Its IUPAC name is 1,1,2-trifluoro-4-hydroxybutane-1-sulfonate;triphenylsulfanium.
| Compound Name | 1,1,2-trifluoro-4-hydroxybutane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 86673630 |
| Molecular Formula | C22H21F3O4S2 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 1,1,2-trifluoro-4-hydroxybutane-1-sulfonate;triphenylsulfanium |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)CCO.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C4H7F3O4S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;5-3(1-2-8)4(6,7)12(9,10)11/h1-15H;3,8H,1-2H2,(H,9,10,11)/q+1;/p-1 |
| InChIKey | GVONCOQCCRXMCN-UHFFFAOYSA-M |
| XLogP | 4.63 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|