C41H55F3O5S2 — CID 86673633
4-(cyclohexanecarbonyloxy)-1,1,2-trifluorobutane-1-sulfonate;tris(4-tert-butylphenyl)sulfanium (PubChem CID 86673633) has the molecular formula C41H55F3O5S2 and a molecular weight of 749.01 g/mol. Its IUPAC name is 4-(cyclohexanecarbonyloxy)-1,1,2-trifluorobutane-1-sulfonate;tris(4-tert-butylphenyl)sulfanium.
| Compound Name | 4-(cyclohexanecarbonyloxy)-1,1,2-trifluorobutane-1-sulfonate;tris(4-tert-butylphenyl)sulfanium |
|---|---|
| PubChem CID | 86673633 |
| Molecular Formula | C41H55F3O5S2 |
| Molecular Weight | 749.01 g/mol |
| Exact Mass | 748.34 |
| IUPAC Name | 4-(cyclohexanecarbonyloxy)-1,1,2-trifluorobutane-1-sulfonate;tris(4-tert-butylphenyl)sulfanium |
| SMILES | CC(C)(C)c1ccc([S+](c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1.O=C(OCCC(F)C(F)(F)S(=O)(=O)[O-])C1CCCCC1 |
| InChI | InChI=1S/C30H39S.C11H17F3O5S/c1-28(2,3)22-10-16-25(17-11-22)31(26-18-12-23(13-19-26)29(4,5)6)27-20-14-24(15-21-27)30(7,8)9;12-9(11(13,14)20(16,17)18)6-7-19-10(15)8-4-2-1-3-5-8/h10-21H,1-9H3;8-9H,1-7H2,(H,16,17,18)/q+1;/p-1 |
| InChIKey | OJUYZRXVTMEUCL-UHFFFAOYSA-M |
| XLogP | 10.65 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.01 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|