C24H34ClNO6 — CID 86673937
diethyl 2-[(1R,3S,4R)-3-(4-chlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]propanedioate (PubChem CID 86673937) has the molecular formula C24H34ClNO6 and a molecular weight of 467.99 g/mol. Its IUPAC name is diethyl 2-[(1R,3S,4R)-3-(4-chlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]propanedioate.
| Compound Name | diethyl 2-[(1R,3S,4R)-3-(4-chlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]propanedioate |
|---|---|
| PubChem CID | 86673937 |
| Molecular Formula | C24H34ClNO6 |
| Molecular Weight | 467.99 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | diethyl 2-[(1R,3S,4R)-3-(4-chlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H]1CC[C@@H](NC(=O)OC(C)(C)C)[C@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C24H34ClNO6/c1-6-30-21(27)20(22(28)31-7-2)16-10-13-19(26-23(29)32-24(3,4)5)18(14-16)15-8-11-17(25)12-9-15/h8-9,11-12,16,18-20H,6-7,10,13-14H2,1-5H3,(H,26,29)/t16-,18+,19-/m1/s1 |
| InChIKey | FQVMOQIOKJMFAM-NZSAHSFTSA-N |
| XLogP | 4.86 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.99 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|