C17H25ClN4O6S — CID 86674064
2-[[(3aR,4S,6R,6aS)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]ethanol (PubChem CID 86674064) has the molecular formula C17H25ClN4O6S and a molecular weight of 448.93 g/mol. Its IUPAC name is 2-[[(3aR,4S,6R,6aS)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]ethanol.
| Compound Name | 2-[[(3aR,4S,6R,6aS)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]ethanol |
|---|---|
| PubChem CID | 86674064 |
| Molecular Formula | C17H25ClN4O6S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-[[(3aR,4S,6R,6aS)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]ethanol |
| SMILES | CCCSc1nc(Cl)c([N+](=O)[O-])c(N[C@@H]2C[C@H](OCCO)[C@H]3OC(C)(C)O[C@H]32)n1 |
| InChI | InChI=1S/C17H25ClN4O6S/c1-4-7-29-16-20-14(18)11(22(24)25)15(21-16)19-9-8-10(26-6-5-23)13-12(9)27-17(2,3)28-13/h9-10,12-13,23H,4-8H2,1-3H3,(H,19,20,21)/t9-,10+,12+,13-/m1/s1 |
| InChIKey | RUAIMTUBSFNCJN-RSLMWUCJSA-N |
| XLogP | 2.62 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|