About (4-chlorothieno[3,2-d]pyrimidin-7-yl)methanol
(4-chlorothieno[3,2-d]pyrimidin-7-yl)methanol (PubChem CID 86674138) has the molecular formula C7H5ClN2OS
and a molecular weight of 200.65 g/mol. Its IUPAC name is (4-chlorothieno[3,2-d]pyrimidin-7-yl)methanol.
Molecular Properties
| Compound Name | (4-chlorothieno[3,2-d]pyrimidin-7-yl)methanol |
| PubChem CID | 86674138 |
| Molecular Formula | C7H5ClN2OS |
| Molecular Weight | 200.65 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | (4-chlorothieno[3,2-d]pyrimidin-7-yl)methanol |
| SMILES | OCc1csc2c(Cl)ncnc12 |
| InChI | InChI=1S/C7H5ClN2OS/c8-7-6-5(9-3-10-7)4(1-11)2-12-6/h2-3,11H,1H2 |
| InChIKey | OPXCKWHOLOWBBT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.65 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-chlorothieno[3,2-d]pyrimidin-7-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorothieno[3,2-d]pyrimidin-7-yl)methanol?
The IUPAC name of (4-chlorothieno[3,2-d]pyrimidin-7-yl)methanol (CID 86674138) is (4-chlorothieno[3,2-d]pyrimidin-7-yl)methanol.
What is the SMILES notation for (4-chlorothieno[3,2-d]pyrimidin-7-yl)methanol?
The canonical SMILES for (4-chlorothieno[3,2-d]pyrimidin-7-yl)methanol is OCc1csc2c(Cl)ncnc12.
What is the InChIKey of (4-chlorothieno[3,2-d]pyrimidin-7-yl)methanol?
The InChIKey is OPXCKWHOLOWBBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2OS/c8-7-6-5(9-3-10-7)4(1-11)2-12-6/h2-3,11H,1H2.
What are the key properties of (4-chlorothieno[3,2-d]pyrimidin-7-yl)methanol?
(4-chlorothieno[3,2-d]pyrimidin-7-yl)methanol has a molecular weight of 200.65 g/mol, XLogP of 1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorothieno[3,2-d]pyrimidin-7-yl)methanol is sourced from PubChem (CID 86674138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).