About N-[3-[(5-bromo-1,3-thiazol-2-yl)amino]phenyl]methanesulfonamide
N-[3-[(5-bromo-1,3-thiazol-2-yl)amino]phenyl]methanesulfonamide (PubChem CID 86674186) has the molecular formula C10H10BrN3O2S2
and a molecular weight of 348.25 g/mol. Its IUPAC name is N-[3-[(5-bromo-1,3-thiazol-2-yl)amino]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-[(5-bromo-1,3-thiazol-2-yl)amino]phenyl]methanesulfonamide |
| PubChem CID | 86674186 |
| Molecular Formula | C10H10BrN3O2S2 |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | N-[3-[(5-bromo-1,3-thiazol-2-yl)amino]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(Nc2ncc(Br)s2)c1 |
| InChI | InChI=1S/C10H10BrN3O2S2/c1-18(15,16)14-8-4-2-3-7(5-8)13-10-12-6-9(11)17-10/h2-6,14H,1H3,(H,12,13) |
| InChIKey | WDBMWXFJFWBAGT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-[(5-bromo-1,3-thiazol-2-yl)amino]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(5-bromo-1,3-thiazol-2-yl)amino]phenyl]methanesulfonamide?
The IUPAC name of N-[3-[(5-bromo-1,3-thiazol-2-yl)amino]phenyl]methanesulfonamide (CID 86674186) is N-[3-[(5-bromo-1,3-thiazol-2-yl)amino]phenyl]methanesulfonamide.
What is the SMILES notation for N-[3-[(5-bromo-1,3-thiazol-2-yl)amino]phenyl]methanesulfonamide?
The canonical SMILES for N-[3-[(5-bromo-1,3-thiazol-2-yl)amino]phenyl]methanesulfonamide is CS(=O)(=O)Nc1cccc(Nc2ncc(Br)s2)c1.
What is the InChIKey of N-[3-[(5-bromo-1,3-thiazol-2-yl)amino]phenyl]methanesulfonamide?
The InChIKey is WDBMWXFJFWBAGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrN3O2S2/c1-18(15,16)14-8-4-2-3-7(5-8)13-10-12-6-9(11)17-10/h2-6,14H,1H3,(H,12,13).
What are the key properties of N-[3-[(5-bromo-1,3-thiazol-2-yl)amino]phenyl]methanesulfonamide?
N-[3-[(5-bromo-1,3-thiazol-2-yl)amino]phenyl]methanesulfonamide has a molecular weight of 348.25 g/mol, XLogP of 3.02, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(5-bromo-1,3-thiazol-2-yl)amino]phenyl]methanesulfonamide is sourced from PubChem (CID 86674186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).