About tetraphenylboranuide;tritert-butylphosphane
tetraphenylboranuide;tritert-butylphosphane (PubChem CID 86674235) has the molecular formula C36H47BP-
and a molecular weight of 521.56 g/mol. Its IUPAC name is tetraphenylboranuide;tritert-butylphosphane.
Molecular Properties
| Compound Name | tetraphenylboranuide;tritert-butylphosphane |
| PubChem CID | 86674235 |
| Molecular Formula | C36H47BP- |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.35 |
| IUPAC Name | tetraphenylboranuide;tritert-butylphosphane |
| SMILES | CC(C)(C)P(C(C)(C)C)C(C)(C)C.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C12H27P/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-10(2,3)13(11(4,5)6)12(7,8)9/h1-20H;1-9H3/q-1; |
| InChIKey | QWISVPBFGJWCBS-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tetraphenylboranuide;tritert-butylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraphenylboranuide;tritert-butylphosphane?
The IUPAC name of tetraphenylboranuide;tritert-butylphosphane (CID 86674235) is tetraphenylboranuide;tritert-butylphosphane.
What is the SMILES notation for tetraphenylboranuide;tritert-butylphosphane?
The canonical SMILES for tetraphenylboranuide;tritert-butylphosphane is CC(C)(C)P(C(C)(C)C)C(C)(C)C.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of tetraphenylboranuide;tritert-butylphosphane?
The InChIKey is QWISVPBFGJWCBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.C12H27P/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-10(2,3)13(11(4,5)6)12(7,8)9/h1-20H;1-9H3/q-1;.
What are the key properties of tetraphenylboranuide;tritert-butylphosphane?
tetraphenylboranuide;tritert-butylphosphane has a molecular weight of 521.56 g/mol, XLogP of 7.93, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetraphenylboranuide;tritert-butylphosphane is sourced from PubChem (CID 86674235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).