C12H3ClF12O4S — CID 86674269
[4-chloro-2-formyl-5-(trifluoromethyl)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 86674269) has the molecular formula C12H3ClF12O4S and a molecular weight of 506.65 g/mol. Its IUPAC name is [4-chloro-2-formyl-5-(trifluoromethyl)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [4-chloro-2-formyl-5-(trifluoromethyl)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 86674269 |
| Molecular Formula | C12H3ClF12O4S |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 505.92 |
| IUPAC Name | [4-chloro-2-formyl-5-(trifluoromethyl)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=Cc1cc(Cl)c(C(F)(F)F)cc1OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H3ClF12O4S/c13-6-1-4(3-26)7(2-5(6)8(14,15)16)29-30(27,28)12(24,25)10(19,20)9(17,18)11(21,22)23/h1-3H |
| InChIKey | RLDZIJGKAYAUPL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|