C7H14ClN — CID 86674493
(3aR,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole;hydrochloride (PubChem CID 86674493) has the molecular formula C7H14ClN and a molecular weight of 147.65 g/mol. Its IUPAC name is (3aR,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole;hydrochloride.
| Compound Name | (3aR,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 86674493 |
| Molecular Formula | C7H14ClN |
| Molecular Weight | 147.65 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | (3aR,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole;hydrochloride |
| SMILES | C1C[C@@H]2CCN[C@@H]2C1.Cl |
| InChI | InChI=1S/C7H13N.ClH/c1-2-6-4-5-8-7(6)3-1;/h6-8H,1-5H2;1H/t6-,7-;/m1./s1 |
| InChIKey | PQAJNJOXKMQYSI-ZJLYAJKPSA-N |
| XLogP | 1.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.65 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |