About benzyl 4-[4-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclohexyl]piperazine-1-carboxylate
benzyl 4-[4-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclohexyl]piperazine-1-carboxylate (PubChem CID 86674632) has the molecular formula C24H28ClN5O2
and a molecular weight of 453.97 g/mol. Its IUPAC name is benzyl 4-[4-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclohexyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 4-[4-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclohexyl]piperazine-1-carboxylate |
| PubChem CID | 86674632 |
| Molecular Formula | C24H28ClN5O2 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | benzyl 4-[4-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclohexyl]piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN(C2CCC(c3ncc4c(Cl)nccn34)CC2)CC1 |
| InChI | InChI=1S/C24H28ClN5O2/c25-22-21-16-27-23(30(21)11-10-26-22)19-6-8-20(9-7-19)28-12-14-29(15-13-28)24(31)32-17-18-4-2-1-3-5-18/h1-5,10-11,16,19-20H,6-9,12-15,17H2 |
| InChIKey | NAIBZVMYEACEKV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl 4-[4-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclohexyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-[4-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclohexyl]piperazine-1-carboxylate?
The IUPAC name of benzyl 4-[4-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclohexyl]piperazine-1-carboxylate (CID 86674632) is benzyl 4-[4-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclohexyl]piperazine-1-carboxylate.
What is the SMILES notation for benzyl 4-[4-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclohexyl]piperazine-1-carboxylate?
The canonical SMILES for benzyl 4-[4-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclohexyl]piperazine-1-carboxylate is O=C(OCc1ccccc1)N1CCN(C2CCC(c3ncc4c(Cl)nccn34)CC2)CC1.
What is the InChIKey of benzyl 4-[4-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclohexyl]piperazine-1-carboxylate?
The InChIKey is NAIBZVMYEACEKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28ClN5O2/c25-22-21-16-27-23(30(21)11-10-26-22)19-6-8-20(9-7-19)28-12-14-29(15-13-28)24(31)32-17-18-4-2-1-3-5-18/h1-5,10-11,16,19-20H,6-9,12-15,17H2.
What are the key properties of benzyl 4-[4-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclohexyl]piperazine-1-carboxylate?
benzyl 4-[4-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclohexyl]piperazine-1-carboxylate has a molecular weight of 453.97 g/mol, XLogP of 4.36, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-[4-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclohexyl]piperazine-1-carboxylate is sourced from PubChem (CID 86674632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).