About N,N-diethylprop-2-enamide;N,N-dimethylprop-2-enamide
N,N-diethylprop-2-enamide;N,N-dimethylprop-2-enamide (PubChem CID 86674667) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is N,N-diethylprop-2-enamide;N,N-dimethylprop-2-enamide.
Molecular Properties
| Compound Name | N,N-diethylprop-2-enamide;N,N-dimethylprop-2-enamide |
| PubChem CID | 86674667 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N,N-diethylprop-2-enamide;N,N-dimethylprop-2-enamide |
| SMILES | C=CC(=O)N(C)C.C=CC(=O)N(CC)CC |
| InChI | InChI=1S/C7H13NO.C5H9NO/c1-4-7(9)8(5-2)6-3;1-4-5(7)6(2)3/h4H,1,5-6H2,2-3H3;4H,1H2,2-3H3 |
| InChIKey | XNXMTZQHNPLRTQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylprop-2-enamide;N,N-dimethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylprop-2-enamide;N,N-dimethylprop-2-enamide?
The IUPAC name of N,N-diethylprop-2-enamide;N,N-dimethylprop-2-enamide (CID 86674667) is N,N-diethylprop-2-enamide;N,N-dimethylprop-2-enamide.
What is the SMILES notation for N,N-diethylprop-2-enamide;N,N-dimethylprop-2-enamide?
The canonical SMILES for N,N-diethylprop-2-enamide;N,N-dimethylprop-2-enamide is C=CC(=O)N(C)C.C=CC(=O)N(CC)CC.
What is the InChIKey of N,N-diethylprop-2-enamide;N,N-dimethylprop-2-enamide?
The InChIKey is XNXMTZQHNPLRTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C5H9NO/c1-4-7(9)8(5-2)6-3;1-4-5(7)6(2)3/h4H,1,5-6H2,2-3H3;4H,1H2,2-3H3.
What are the key properties of N,N-diethylprop-2-enamide;N,N-dimethylprop-2-enamide?
N,N-diethylprop-2-enamide;N,N-dimethylprop-2-enamide has a molecular weight of 226.32 g/mol, XLogP of 1.30, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylprop-2-enamide;N,N-dimethylprop-2-enamide is sourced from PubChem (CID 86674667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).