C20H26F5N3O3 — CID 86674789
5-cyclopropyl-N-[(2S)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]-6-(2,2,3,3,3-pentafluoropropoxy)pyridine-2-carboxamide (PubChem CID 86674789) has the molecular formula C20H26F5N3O3 and a molecular weight of 451.44 g/mol. Its IUPAC name is 5-cyclopropyl-N-[(2S)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]-6-(2,2,3,3,3-pentafluoropropoxy)pyridine-2-carboxamide.
| Compound Name | 5-cyclopropyl-N-[(2S)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]-6-(2,2,3,3,3-pentafluoropropoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 86674789 |
| Molecular Formula | C20H26F5N3O3 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 5-cyclopropyl-N-[(2S)-4,4-dimethyl-1-(methylamino)-1-oxopentan-2-yl]-6-(2,2,3,3,3-pentafluoropropoxy)pyridine-2-carboxamide |
| SMILES | CNC(=O)[C@H](CC(C)(C)C)NC(=O)c1ccc(C2CC2)c(OCC(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C20H26F5N3O3/c1-18(2,3)9-14(15(29)26-4)27-16(30)13-8-7-12(11-5-6-11)17(28-13)31-10-19(21,22)20(23,24)25/h7-8,11,14H,5-6,9-10H2,1-4H3,(H,26,29)(H,27,30)/t14-/m0/s1 |
| InChIKey | MNVJXLACEBDMRB-AWEZNQCLSA-N |
| XLogP | 3.82 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|