About 5-ethenyl-2-(3-nitro-1,2,4-triazol-1-yl)benzonitrile
5-ethenyl-2-(3-nitro-1,2,4-triazol-1-yl)benzonitrile (PubChem CID 86675216) has the molecular formula C11H7N5O2
and a molecular weight of 241.21 g/mol. Its IUPAC name is 5-ethenyl-2-(3-nitro-1,2,4-triazol-1-yl)benzonitrile.
Molecular Properties
| Compound Name | 5-ethenyl-2-(3-nitro-1,2,4-triazol-1-yl)benzonitrile |
| PubChem CID | 86675216 |
| Molecular Formula | C11H7N5O2 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 5-ethenyl-2-(3-nitro-1,2,4-triazol-1-yl)benzonitrile |
| SMILES | C=Cc1ccc(-n2cnc([N+](=O)[O-])n2)c(C#N)c1 |
| InChI | InChI=1S/C11H7N5O2/c1-2-8-3-4-10(9(5-8)6-12)15-7-13-11(14-15)16(17)18/h2-5,7H,1H2 |
| InChIKey | UZKJXGFFUYCJKP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 97.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyl-2-(3-nitro-1,2,4-triazol-1-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-2-(3-nitro-1,2,4-triazol-1-yl)benzonitrile?
The IUPAC name of 5-ethenyl-2-(3-nitro-1,2,4-triazol-1-yl)benzonitrile (CID 86675216) is 5-ethenyl-2-(3-nitro-1,2,4-triazol-1-yl)benzonitrile.
What is the SMILES notation for 5-ethenyl-2-(3-nitro-1,2,4-triazol-1-yl)benzonitrile?
The canonical SMILES for 5-ethenyl-2-(3-nitro-1,2,4-triazol-1-yl)benzonitrile is C=Cc1ccc(-n2cnc([N+](=O)[O-])n2)c(C#N)c1.
What is the InChIKey of 5-ethenyl-2-(3-nitro-1,2,4-triazol-1-yl)benzonitrile?
The InChIKey is UZKJXGFFUYCJKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N5O2/c1-2-8-3-4-10(9(5-8)6-12)15-7-13-11(14-15)16(17)18/h2-5,7H,1H2.
What are the key properties of 5-ethenyl-2-(3-nitro-1,2,4-triazol-1-yl)benzonitrile?
5-ethenyl-2-(3-nitro-1,2,4-triazol-1-yl)benzonitrile has a molecular weight of 241.21 g/mol, XLogP of 1.69, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-2-(3-nitro-1,2,4-triazol-1-yl)benzonitrile is sourced from PubChem (CID 86675216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).