C18H27F2N3O2 — CID 86675337
3-(difluoromethyl)-N-methoxy-1-methyl-N-[1-(2,2,4-trimethylcyclohex-3-en-1-yl)ethyl]pyrazole-4-carboxamide (PubChem CID 86675337) has the molecular formula C18H27F2N3O2 and a molecular weight of 355.43 g/mol. Its IUPAC name is 3-(difluoromethyl)-N-methoxy-1-methyl-N-[1-(2,2,4-trimethylcyclohex-3-en-1-yl)ethyl]pyrazole-4-carboxamide.
| Compound Name | 3-(difluoromethyl)-N-methoxy-1-methyl-N-[1-(2,2,4-trimethylcyclohex-3-en-1-yl)ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86675337 |
| Molecular Formula | C18H27F2N3O2 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 3-(difluoromethyl)-N-methoxy-1-methyl-N-[1-(2,2,4-trimethylcyclohex-3-en-1-yl)ethyl]pyrazole-4-carboxamide |
| SMILES | CON(C(=O)c1cn(C)nc1C(F)F)C(C)C1CCC(C)=CC1(C)C |
| InChI | InChI=1S/C18H27F2N3O2/c1-11-7-8-14(18(3,4)9-11)12(2)23(25-6)17(24)13-10-22(5)21-15(13)16(19)20/h9-10,12,14,16H,7-8H2,1-6H3 |
| InChIKey | PVSNACCGHQJHRT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|