C28H27Cl2F2N3O7S2 — CID 86675428
[(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] (2S)-3-(4-aminophenyl)sulfonyl-1,3-thiazolidine-2-carboxylate (PubChem CID 86675428) has the molecular formula C28H27Cl2F2N3O7S2 and a molecular weight of 690.57 g/mol. Its IUPAC name is [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] (2S)-3-(4-aminophenyl)sulfonyl-1,3-thiazolidine-2-carboxylate.
| Compound Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] (2S)-3-(4-aminophenyl)sulfonyl-1,3-thiazolidine-2-carboxylate |
|---|---|
| PubChem CID | 86675428 |
| Molecular Formula | C28H27Cl2F2N3O7S2 |
| Molecular Weight | 690.57 g/mol |
| Exact Mass | 689.06 |
| IUPAC Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] (2S)-3-(4-aminophenyl)sulfonyl-1,3-thiazolidine-2-carboxylate |
| SMILES | Nc1ccc(S(=O)(=O)N2CCS[C@H]2C(=O)O[C@@H](Cc2c(Cl)c[n+]([O-])cc2Cl)c2ccc(OC(F)F)c(OCC3CC3)c2)cc1 |
| InChI | InChI=1S/C28H27Cl2F2N3O7S2/c29-21-13-34(37)14-22(30)20(21)12-24(17-3-8-23(42-28(31)32)25(11-17)40-15-16-1-2-16)41-27(36)26-35(9-10-43-26)44(38,39)19-6-4-18(33)5-7-19/h3-8,11,13-14,16,24,26,28H,1-2,9-10,12,15,33H2/t24-,26-/m0/s1 |
| InChIKey | ZUDBENSYOYSHEH-AHWVRZQESA-N |
| XLogP | 5.19 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|