C22H19F2N3O2 — CID 86675532
1-[(2-amino-3,5-difluorophenyl)methyl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylquinolin-4-one (PubChem CID 86675532) has the molecular formula C22H19F2N3O2 and a molecular weight of 395.41 g/mol. Its IUPAC name is 1-[(2-amino-3,5-difluorophenyl)methyl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylquinolin-4-one.
| Compound Name | 1-[(2-amino-3,5-difluorophenyl)methyl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylquinolin-4-one |
|---|---|
| PubChem CID | 86675532 |
| Molecular Formula | C22H19F2N3O2 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 1-[(2-amino-3,5-difluorophenyl)methyl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylquinolin-4-one |
| SMILES | Cc1noc(C)c1-c1ccc2c(=O)cc(C)n(Cc3cc(F)cc(F)c3N)c2c1 |
| InChI | InChI=1S/C22H19F2N3O2/c1-11-6-20(28)17-5-4-14(21-12(2)26-29-13(21)3)8-19(17)27(11)10-15-7-16(23)9-18(24)22(15)25/h4-9H,10,25H2,1-3H3 |
| InChIKey | OFAOYNFGCSYRIX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|