C10H2Cl2F9N3 — CID 86675636
2-azido-1,3-dichloro-5-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene (PubChem CID 86675636) has the molecular formula C10H2Cl2F9N3 and a molecular weight of 406.04 g/mol. Its IUPAC name is 2-azido-1,3-dichloro-5-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene.
| Compound Name | 2-azido-1,3-dichloro-5-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene |
|---|---|
| PubChem CID | 86675636 |
| Molecular Formula | C10H2Cl2F9N3 |
| Molecular Weight | 406.04 g/mol |
| Exact Mass | 404.95 |
| IUPAC Name | 2-azido-1,3-dichloro-5-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene |
| SMILES | [N-]=[N+]=Nc1c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H2Cl2F9N3/c11-4-1-3(2-5(12)6(4)23-24-22)7(13,9(16,17)18)8(14,15)10(19,20)21/h1-2H |
| InChIKey | XQQCSNOADUHJFQ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.04 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|