C14H18FNO4 — CID 8667574
[(2R)-1-(ethylamino)-1-oxopropan-2-yl] 2-(3-fluoro-4-methoxyphenyl)acetate (PubChem CID 8667574) has the molecular formula C14H18FNO4 and a molecular weight of 283.30 g/mol. Its IUPAC name is [(2R)-1-(ethylamino)-1-oxopropan-2-yl] 2-(3-fluoro-4-methoxyphenyl)acetate.
| Compound Name | [(2R)-1-(ethylamino)-1-oxopropan-2-yl] 2-(3-fluoro-4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 8667574 |
| Molecular Formula | C14H18FNO4 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | [(2R)-1-(ethylamino)-1-oxopropan-2-yl] 2-(3-fluoro-4-methoxyphenyl)acetate |
| SMILES | CCNC(=O)[C@@H](C)OC(=O)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C14H18FNO4/c1-4-16-14(18)9(2)20-13(17)8-10-5-6-12(19-3)11(15)7-10/h5-7,9H,4,8H2,1-3H3,(H,16,18)/t9-/m1/s1 |
| InChIKey | UYCQOBDNROKLEE-SECBINFHSA-N |
| XLogP | 1.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |