C15H28O5 — CID 86675851
[(2S,3S,4R,5R)-3,5-dimethoxy-2,4-dimethyl-6-oxohexyl] 2,2-dimethylpropanoate (PubChem CID 86675851) has the molecular formula C15H28O5 and a molecular weight of 288.38 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-3,5-dimethoxy-2,4-dimethyl-6-oxohexyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,3S,4R,5R)-3,5-dimethoxy-2,4-dimethyl-6-oxohexyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 86675851 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | [(2S,3S,4R,5R)-3,5-dimethoxy-2,4-dimethyl-6-oxohexyl] 2,2-dimethylpropanoate |
| SMILES | CO[C@H]([C@@H](C)[C@H](C=O)OC)[C@@H](C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H28O5/c1-10(9-20-14(17)15(3,4)5)13(19-7)11(2)12(8-16)18-6/h8,10-13H,9H2,1-7H3/t10-,11-,12-,13-/m0/s1 |
| InChIKey | OADRCEYBSLHGHK-CYDGBPFRSA-N |
| XLogP | 2.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|