C13H22O3 — CID 86675854
(2R,3R,4S,5S,6E)-3,5-dimethoxy-2,4-dimethylnona-6,8-dienal (PubChem CID 86675854) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (2R,3R,4S,5S,6E)-3,5-dimethoxy-2,4-dimethylnona-6,8-dienal.
| Compound Name | (2R,3R,4S,5S,6E)-3,5-dimethoxy-2,4-dimethylnona-6,8-dienal |
|---|---|
| PubChem CID | 86675854 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (2R,3R,4S,5S,6E)-3,5-dimethoxy-2,4-dimethylnona-6,8-dienal |
| SMILES | C=C/C=C/[C@H](OC)[C@H](C)[C@@H](OC)C(C)C=O |
| InChI | InChI=1S/C13H22O3/c1-6-7-8-12(15-4)11(3)13(16-5)10(2)9-14/h6-13H,1H2,2-5H3/b8-7+/t10?,11-,12-,13-/m0/s1 |
| InChIKey | BSVQOFQQTBPOEM-JPRQAVPYSA-N |
| XLogP | 2.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|