C23H46O3Sn — CID 86675858
(E,2R,3R,4R,5R)-3,5-dimethoxy-2,4-dimethyl-7-tributylstannylhept-6-enal (PubChem CID 86675858) has the molecular formula C23H46O3Sn and a molecular weight of 489.33 g/mol. Its IUPAC name is (E,2R,3R,4R,5R)-3,5-dimethoxy-2,4-dimethyl-7-tributylstannylhept-6-enal.
| Compound Name | (E,2R,3R,4R,5R)-3,5-dimethoxy-2,4-dimethyl-7-tributylstannylhept-6-enal |
|---|---|
| PubChem CID | 86675858 |
| Molecular Formula | C23H46O3Sn |
| Molecular Weight | 489.33 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | (E,2R,3R,4R,5R)-3,5-dimethoxy-2,4-dimethyl-7-tributylstannylhept-6-enal |
| SMILES | CCCC[Sn](/C=C/[C@H](OC)[C@H](C)[C@@H](OC)[C@@H](C)C=O)(CCCC)CCCC |
| InChI | InChI=1S/C11H19O3.3C4H9.Sn/c1-6-10(13-4)9(3)11(14-5)8(2)7-12;3*1-3-4-2;/h1,6-11H,2-5H3;3*1,3-4H2,2H3;/t8-,9-,10-,11-;;;;/m0..../s1 |
| InChIKey | BJCNPNKZDGXFMG-NNWLFPQKSA-N |
| XLogP | 6.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.33 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|