About [(2R,5S)-5-ethenyl-1,4-dioxan-2-yl]methanol
[(2R,5S)-5-ethenyl-1,4-dioxan-2-yl]methanol (PubChem CID 86675914) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is [(2R,5S)-5-ethenyl-1,4-dioxan-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R,5S)-5-ethenyl-1,4-dioxan-2-yl]methanol |
| PubChem CID | 86675914 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | [(2R,5S)-5-ethenyl-1,4-dioxan-2-yl]methanol |
| SMILES | C=C[C@H]1CO[C@H](CO)CO1 |
| InChI | InChI=1S/C7H12O3/c1-2-6-4-10-7(3-8)5-9-6/h2,6-8H,1,3-5H2/t6-,7+/m0/s1 |
| InChIKey | VRHJJGYNOIACRE-NKWVEPMBSA-N |
| XLogP | -0.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R,5S)-5-ethenyl-1,4-dioxan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,5S)-5-ethenyl-1,4-dioxan-2-yl]methanol?
The IUPAC name of [(2R,5S)-5-ethenyl-1,4-dioxan-2-yl]methanol (CID 86675914) is [(2R,5S)-5-ethenyl-1,4-dioxan-2-yl]methanol.
What is the SMILES notation for [(2R,5S)-5-ethenyl-1,4-dioxan-2-yl]methanol?
The canonical SMILES for [(2R,5S)-5-ethenyl-1,4-dioxan-2-yl]methanol is C=C[C@H]1CO[C@H](CO)CO1.
What is the InChIKey of [(2R,5S)-5-ethenyl-1,4-dioxan-2-yl]methanol?
The InChIKey is VRHJJGYNOIACRE-NKWVEPMBSA-N. The full InChI is InChI=1S/C7H12O3/c1-2-6-4-10-7(3-8)5-9-6/h2,6-8H,1,3-5H2/t6-,7+/m0/s1.
What are the key properties of [(2R,5S)-5-ethenyl-1,4-dioxan-2-yl]methanol?
[(2R,5S)-5-ethenyl-1,4-dioxan-2-yl]methanol has a molecular weight of 144.17 g/mol, XLogP of -0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,5S)-5-ethenyl-1,4-dioxan-2-yl]methanol is sourced from PubChem (CID 86675914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).