C22H27F5O3 — CID 86676105
(8S,13S,14S,17S)-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)spiro[1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-ol (PubChem CID 86676105) has the molecular formula C22H27F5O3 and a molecular weight of 434.45 g/mol. Its IUPAC name is (8S,13S,14S,17S)-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)spiro[1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-ol.
| Compound Name | (8S,13S,14S,17S)-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)spiro[1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-ol |
|---|---|
| PubChem CID | 86676105 |
| Molecular Formula | C22H27F5O3 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (8S,13S,14S,17S)-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)spiro[1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-ol |
| SMILES | C[C@]12CC=C3C4=C(CC[C@H]3[C@@H]1CC[C@@]2(O)C(F)(F)C(F)(F)F)CC1(CC4)OCCO1 |
| InChI | InChI=1S/C22H27F5O3/c1-18-7-4-15-14-5-8-19(29-10-11-30-19)12-13(14)2-3-16(15)17(18)6-9-20(18,28)21(23,24)22(25,26)27/h4,16-17,28H,2-3,5-12H2,1H3/t16-,17+,18+,20+/m1/s1 |
| InChIKey | KVZHXEXAVTYIJT-LXZJYRNTSA-N |
| XLogP | 5.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|